C17H21N5OS — CID 119432081
1,3-dimethyl-N-[3-(methylamino)propyl]-6-thiophen-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 119432081) has the molecular formula C17H21N5OS and a molecular weight of 343.46 g/mol. Its IUPAC name is 1,3-dimethyl-N-[3-(methylamino)propyl]-6-thiophen-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | 1,3-dimethyl-N-[3-(methylamino)propyl]-6-thiophen-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 119432081 |
| Molecular Formula | C17H21N5OS |
| Molecular Weight | 343.46 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 1,3-dimethyl-N-[3-(methylamino)propyl]-6-thiophen-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | CNCCCNC(=O)c1cc(-c2cccs2)nc2c1c(C)nn2C |
| InChI | InChI=1S/C17H21N5OS/c1-11-15-12(17(23)19-8-5-7-18-2)10-13(14-6-4-9-24-14)20-16(15)22(3)21-11/h4,6,9-10,18H,5,7-8H2,1-3H3,(H,19,23) |
| InChIKey | GILYTTDWBMFVFO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|