About N-[3-(methylamino)propyl]tricyclo[3.2.1.02,4]octane-3-carboxamide;hydrochloride
N-[3-(methylamino)propyl]tricyclo[3.2.1.02,4]octane-3-carboxamide;hydrochloride (PubChem CID 119432515) has the molecular formula C13H23ClN2O
and a molecular weight of 258.79 g/mol. Its IUPAC name is N-[3-(methylamino)propyl]tricyclo[3.2.1.02,4]octane-3-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | N-[3-(methylamino)propyl]tricyclo[3.2.1.02,4]octane-3-carboxamide;hydrochloride |
| PubChem CID | 119432515 |
| Molecular Formula | C13H23ClN2O |
| Molecular Weight | 258.79 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | N-[3-(methylamino)propyl]tricyclo[3.2.1.02,4]octane-3-carboxamide;hydrochloride |
| SMILES | CNCCCNC(=O)C1C2C3CCC(C3)C12.Cl |
| InChI | InChI=1S/C13H22N2O.ClH/c1-14-5-2-6-15-13(16)12-10-8-3-4-9(7-8)11(10)12;/h8-12,14H,2-7H2,1H3,(H,15,16);1H |
| InChIKey | YVROSCUNVKCFPN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.79 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(methylamino)propyl]tricyclo[3.2.1.02,4]octane-3-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(methylamino)propyl]tricyclo[3.2.1.02,4]octane-3-carboxamide;hydrochloride?
The IUPAC name of N-[3-(methylamino)propyl]tricyclo[3.2.1.02,4]octane-3-carboxamide;hydrochloride (CID 119432515) is N-[3-(methylamino)propyl]tricyclo[3.2.1.02,4]octane-3-carboxamide;hydrochloride.
What is the SMILES notation for N-[3-(methylamino)propyl]tricyclo[3.2.1.02,4]octane-3-carboxamide;hydrochloride?
The canonical SMILES for N-[3-(methylamino)propyl]tricyclo[3.2.1.02,4]octane-3-carboxamide;hydrochloride is CNCCCNC(=O)C1C2C3CCC(C3)C12.Cl.
What is the InChIKey of N-[3-(methylamino)propyl]tricyclo[3.2.1.02,4]octane-3-carboxamide;hydrochloride?
The InChIKey is YVROSCUNVKCFPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O.ClH/c1-14-5-2-6-15-13(16)12-10-8-3-4-9(7-8)11(10)12;/h8-12,14H,2-7H2,1H3,(H,15,16);1H.
What are the key properties of N-[3-(methylamino)propyl]tricyclo[3.2.1.02,4]octane-3-carboxamide;hydrochloride?
N-[3-(methylamino)propyl]tricyclo[3.2.1.02,4]octane-3-carboxamide;hydrochloride has a molecular weight of 258.79 g/mol, XLogP of 1.43, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(methylamino)propyl]tricyclo[3.2.1.02,4]octane-3-carboxamide;hydrochloride is sourced from PubChem (CID 119432515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).