C14H21Cl2N5O3 — CID 119432864
1,3-dimethyl-N-[3-(methylamino)propyl]-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxamide;dihydrochloride (PubChem CID 119432864) has the molecular formula C14H21Cl2N5O3 and a molecular weight of 378.26 g/mol. Its IUPAC name is 1,3-dimethyl-N-[3-(methylamino)propyl]-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxamide;dihydrochloride.
| Compound Name | 1,3-dimethyl-N-[3-(methylamino)propyl]-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119432864 |
| Molecular Formula | C14H21Cl2N5O3 |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 1,3-dimethyl-N-[3-(methylamino)propyl]-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxamide;dihydrochloride |
| SMILES | CNCCCNC(=O)c1ccc2c(=O)n(C)c(=O)n(C)c2n1.Cl.Cl |
| InChI | InChI=1S/C14H19N5O3.2ClH/c1-15-7-4-8-16-12(20)10-6-5-9-11(17-10)18(2)14(22)19(3)13(9)21;;/h5-6,15H,4,7-8H2,1-3H3,(H,16,20);2*1H |
| InChIKey | NLBFYEXPYDLIRB-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|