C17H32N4OS — CID 11943338
1-[[(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-(2-morpholin-4-ylethyl)thiourea (PubChem CID 11943338) has the molecular formula C17H32N4OS and a molecular weight of 340.54 g/mol. Its IUPAC name is 1-[[(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-[[(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 11943338 |
| Molecular Formula | C17H32N4OS |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | 1-[[(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-(2-morpholin-4-ylethyl)thiourea |
| SMILES | CC[C@H]1CN2CC[C@H]1C[C@@H]2CNC(=S)NCCN1CCOCC1 |
| InChI | InChI=1S/C17H32N4OS/c1-2-14-13-21-5-3-15(14)11-16(21)12-19-17(23)18-4-6-20-7-9-22-10-8-20/h14-16H,2-13H2,1H3,(H2,18,19,23)/t14-,15-,16+/m0/s1 |
| InChIKey | QXUSIUUIOTVUKG-HRCADAONSA-N |
| XLogP | 0.90 |
| TPSA | 39.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|