About 2-cyclopentyl-4-methyl-N-[3-(methylamino)propyl]-1,3-thiazole-5-carboxamide;dihydrochloride
2-cyclopentyl-4-methyl-N-[3-(methylamino)propyl]-1,3-thiazole-5-carboxamide;dihydrochloride (PubChem CID 119433713) has the molecular formula C14H25Cl2N3OS
and a molecular weight of 354.35 g/mol. Its IUPAC name is 2-cyclopentyl-4-methyl-N-[3-(methylamino)propyl]-1,3-thiazole-5-carboxamide;dihydrochloride.
Molecular Properties
| Compound Name | 2-cyclopentyl-4-methyl-N-[3-(methylamino)propyl]-1,3-thiazole-5-carboxamide;dihydrochloride |
| PubChem CID | 119433713 |
| Molecular Formula | C14H25Cl2N3OS |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 2-cyclopentyl-4-methyl-N-[3-(methylamino)propyl]-1,3-thiazole-5-carboxamide;dihydrochloride |
| SMILES | CNCCCNC(=O)c1sc(C2CCCC2)nc1C.Cl.Cl |
| InChI | InChI=1S/C14H23N3OS.2ClH/c1-10-12(13(18)16-9-5-8-15-2)19-14(17-10)11-6-3-4-7-11;;/h11,15H,3-9H2,1-2H3,(H,16,18);2*1H |
| InChIKey | DLSIOZHOAIMBOP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopentyl-4-methyl-N-[3-(methylamino)propyl]-1,3-thiazole-5-carboxamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentyl-4-methyl-N-[3-(methylamino)propyl]-1,3-thiazole-5-carboxamide;dihydrochloride?
The IUPAC name of 2-cyclopentyl-4-methyl-N-[3-(methylamino)propyl]-1,3-thiazole-5-carboxamide;dihydrochloride (CID 119433713) is 2-cyclopentyl-4-methyl-N-[3-(methylamino)propyl]-1,3-thiazole-5-carboxamide;dihydrochloride.
What is the SMILES notation for 2-cyclopentyl-4-methyl-N-[3-(methylamino)propyl]-1,3-thiazole-5-carboxamide;dihydrochloride?
The canonical SMILES for 2-cyclopentyl-4-methyl-N-[3-(methylamino)propyl]-1,3-thiazole-5-carboxamide;dihydrochloride is CNCCCNC(=O)c1sc(C2CCCC2)nc1C.Cl.Cl.
What is the InChIKey of 2-cyclopentyl-4-methyl-N-[3-(methylamino)propyl]-1,3-thiazole-5-carboxamide;dihydrochloride?
The InChIKey is DLSIOZHOAIMBOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3OS.2ClH/c1-10-12(13(18)16-9-5-8-15-2)19-14(17-10)11-6-3-4-7-11;;/h11,15H,3-9H2,1-2H3,(H,16,18);2*1H.
What are the key properties of 2-cyclopentyl-4-methyl-N-[3-(methylamino)propyl]-1,3-thiazole-5-carboxamide;dihydrochloride?
2-cyclopentyl-4-methyl-N-[3-(methylamino)propyl]-1,3-thiazole-5-carboxamide;dihydrochloride has a molecular weight of 354.35 g/mol, XLogP of 3.29, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentyl-4-methyl-N-[3-(methylamino)propyl]-1,3-thiazole-5-carboxamide;dihydrochloride is sourced from PubChem (CID 119433713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).