C18H22N2O3 — CID 11943384
2-[[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methylcarbamoyl]benzoic acid (PubChem CID 11943384) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is 2-[[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methylcarbamoyl]benzoic acid.
| Compound Name | 2-[[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methylcarbamoyl]benzoic acid |
|---|---|
| PubChem CID | 11943384 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 2-[[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methylcarbamoyl]benzoic acid |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@@H]2CNC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C18H22N2O3/c1-2-12-11-20-8-7-13(12)9-14(20)10-19-17(21)15-5-3-4-6-16(15)18(22)23/h2-6,12-14H,1,7-11H2,(H,19,21)(H,22,23)/t12-,13-,14+/m0/s1 |
| InChIKey | DZLCBOWVRMHHDJ-MELADBBJSA-N |
| XLogP | 2.01 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|