C19H30N2O3 — CID 11943385
2-[1-[2-[[(2R,4S,5R)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]methylamino]-2-oxoethyl]cyclopentyl]acetate (PubChem CID 11943385) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is 2-[1-[2-[[(2R,4S,5R)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]methylamino]-2-oxoethyl]cyclopentyl]acetate.
| Compound Name | 2-[1-[2-[[(2R,4S,5R)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]methylamino]-2-oxoethyl]cyclopentyl]acetate |
|---|---|
| PubChem CID | 11943385 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | 2-[1-[2-[[(2R,4S,5R)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]methylamino]-2-oxoethyl]cyclopentyl]acetate |
| SMILES | C=C[C@H]1C[NH+]2CC[C@H]1C[C@@H]2CNC(=O)CC1(CC(=O)[O-])CCCC1 |
| InChI | InChI=1S/C19H30N2O3/c1-2-14-13-21-8-5-15(14)9-16(21)12-20-17(22)10-19(11-18(23)24)6-3-4-7-19/h2,14-16H,1,3-13H2,(H,20,22)(H,23,24)/t14-,15-,16+/m0/s1 |
| InChIKey | ZGYUSGIGQDEQMQ-HRCADAONSA-N |
| XLogP | -0.33 |
| TPSA | 73.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|