C14H25N3O2 — CID 119434406
1-[2-[2-(1-aminoethyl)piperidine-1-carbonyl]pyrrolidin-1-yl]ethanone (PubChem CID 119434406) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is 1-[2-[2-(1-aminoethyl)piperidine-1-carbonyl]pyrrolidin-1-yl]ethanone.
| Compound Name | 1-[2-[2-(1-aminoethyl)piperidine-1-carbonyl]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 119434406 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | 1-[2-[2-(1-aminoethyl)piperidine-1-carbonyl]pyrrolidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCCC1C(=O)N1CCCCC1C(C)N |
| InChI | InChI=1S/C14H25N3O2/c1-10(15)12-6-3-4-8-17(12)14(19)13-7-5-9-16(13)11(2)18/h10,12-13H,3-9,15H2,1-2H3 |
| InChIKey | FQTRGOVLANAHNO-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |