C15H22ClN3O4 — CID 119434490
1-[2-(1-aminoethyl)piperidin-1-yl]-2-(3-nitrophenoxy)ethanone;hydrochloride (PubChem CID 119434490) has the molecular formula C15H22ClN3O4 and a molecular weight of 343.81 g/mol. Its IUPAC name is 1-[2-(1-aminoethyl)piperidin-1-yl]-2-(3-nitrophenoxy)ethanone;hydrochloride.
| Compound Name | 1-[2-(1-aminoethyl)piperidin-1-yl]-2-(3-nitrophenoxy)ethanone;hydrochloride |
|---|---|
| PubChem CID | 119434490 |
| Molecular Formula | C15H22ClN3O4 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 1-[2-(1-aminoethyl)piperidin-1-yl]-2-(3-nitrophenoxy)ethanone;hydrochloride |
| SMILES | CC(N)C1CCCCN1C(=O)COc1cccc([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C15H21N3O4.ClH/c1-11(16)14-7-2-3-8-17(14)15(19)10-22-13-6-4-5-12(9-13)18(20)21;/h4-6,9,11,14H,2-3,7-8,10,16H2,1H3;1H |
| InChIKey | HWLTUNWSPVUXAV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|