C16H24BrClN2OS — CID 119435485
1-[2-(1-aminoethyl)piperidin-1-yl]-3-(2-bromophenyl)sulfanylpropan-1-one;hydrochloride (PubChem CID 119435485) has the molecular formula C16H24BrClN2OS and a molecular weight of 407.81 g/mol. Its IUPAC name is 1-[2-(1-aminoethyl)piperidin-1-yl]-3-(2-bromophenyl)sulfanylpropan-1-one;hydrochloride.
| Compound Name | 1-[2-(1-aminoethyl)piperidin-1-yl]-3-(2-bromophenyl)sulfanylpropan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119435485 |
| Molecular Formula | C16H24BrClN2OS |
| Molecular Weight | 407.81 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | 1-[2-(1-aminoethyl)piperidin-1-yl]-3-(2-bromophenyl)sulfanylpropan-1-one;hydrochloride |
| SMILES | CC(N)C1CCCCN1C(=O)CCSc1ccccc1Br.Cl |
| InChI | InChI=1S/C16H23BrN2OS.ClH/c1-12(18)14-7-4-5-10-19(14)16(20)9-11-21-15-8-3-2-6-13(15)17;/h2-3,6,8,12,14H,4-5,7,9-11,18H2,1H3;1H |
| InChIKey | QDQYIMRYGIVMBE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.81 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |