C14H22Cl2N2OS — CID 119435553
1-[2-(1-aminoethyl)piperidin-1-yl]-3-(5-chlorothiophen-2-yl)propan-1-one;hydrochloride (PubChem CID 119435553) has the molecular formula C14H22Cl2N2OS and a molecular weight of 337.32 g/mol. Its IUPAC name is 1-[2-(1-aminoethyl)piperidin-1-yl]-3-(5-chlorothiophen-2-yl)propan-1-one;hydrochloride.
| Compound Name | 1-[2-(1-aminoethyl)piperidin-1-yl]-3-(5-chlorothiophen-2-yl)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119435553 |
| Molecular Formula | C14H22Cl2N2OS |
| Molecular Weight | 337.32 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 1-[2-(1-aminoethyl)piperidin-1-yl]-3-(5-chlorothiophen-2-yl)propan-1-one;hydrochloride |
| SMILES | CC(N)C1CCCCN1C(=O)CCc1ccc(Cl)s1.Cl |
| InChI | InChI=1S/C14H21ClN2OS.ClH/c1-10(16)12-4-2-3-9-17(12)14(18)8-6-11-5-7-13(15)19-11;/h5,7,10,12H,2-4,6,8-9,16H2,1H3;1H |
| InChIKey | HIPBXKQIGPSWMC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |