C15H22ClN3O3 — CID 119436534
[2-(1-aminoethyl)piperidin-1-yl]-(4-methyl-3-nitrophenyl)methanone;hydrochloride (PubChem CID 119436534) has the molecular formula C15H22ClN3O3 and a molecular weight of 327.81 g/mol. Its IUPAC name is [2-(1-aminoethyl)piperidin-1-yl]-(4-methyl-3-nitrophenyl)methanone;hydrochloride.
| Compound Name | [2-(1-aminoethyl)piperidin-1-yl]-(4-methyl-3-nitrophenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119436534 |
| Molecular Formula | C15H22ClN3O3 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | [2-(1-aminoethyl)piperidin-1-yl]-(4-methyl-3-nitrophenyl)methanone;hydrochloride |
| SMILES | Cc1ccc(C(=O)N2CCCCC2C(C)N)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C15H21N3O3.ClH/c1-10-6-7-12(9-14(10)18(20)21)15(19)17-8-4-3-5-13(17)11(2)16;/h6-7,9,11,13H,3-5,8,16H2,1-2H3;1H |
| InChIKey | HFOPYSSZXLKQOO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|