C20H29ClN4O3 — CID 119438447
N-[3-(ethylaminomethyl)phenyl]-2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide;hydrochloride (PubChem CID 119438447) has the molecular formula C20H29ClN4O3 and a molecular weight of 408.93 g/mol. Its IUPAC name is N-[3-(ethylaminomethyl)phenyl]-2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide;hydrochloride.
| Compound Name | N-[3-(ethylaminomethyl)phenyl]-2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119438447 |
| Molecular Formula | C20H29ClN4O3 |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | N-[3-(ethylaminomethyl)phenyl]-2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide;hydrochloride |
| SMILES | CCNCc1cccc(NC(=O)CN2C(=O)NC3(CCCCC3C)C2=O)c1.Cl |
| InChI | InChI=1S/C20H28N4O3.ClH/c1-3-21-12-15-8-6-9-16(11-15)22-17(25)13-24-18(26)20(23-19(24)27)10-5-4-7-14(20)2;/h6,8-9,11,14,21H,3-5,7,10,12-13H2,1-2H3,(H,22,25)(H,23,27);1H |
| InChIKey | VWWDZRSVRVGHNW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|