C18H25NO3 — CID 11943859
methyl (1S,4aR,4bR,8aR,9aR)-8a-cyano-1,4a-dimethyl-7-oxo-3,4,4b,5,6,8,9,9a-octahydro-2H-fluorene-1-carboxylate (PubChem CID 11943859) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is methyl (1S,4aR,4bR,8aR,9aR)-8a-cyano-1,4a-dimethyl-7-oxo-3,4,4b,5,6,8,9,9a-octahydro-2H-fluorene-1-carboxylate.
| Compound Name | methyl (1S,4aR,4bR,8aR,9aR)-8a-cyano-1,4a-dimethyl-7-oxo-3,4,4b,5,6,8,9,9a-octahydro-2H-fluorene-1-carboxylate |
|---|---|
| PubChem CID | 11943859 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | methyl (1S,4aR,4bR,8aR,9aR)-8a-cyano-1,4a-dimethyl-7-oxo-3,4,4b,5,6,8,9,9a-octahydro-2H-fluorene-1-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CCC[C@@]2(C)[C@H]1C[C@@]1(C#N)CC(=O)CC[C@@H]12 |
| InChI | InChI=1S/C18H25NO3/c1-16-7-4-8-17(2,15(21)22-3)14(16)10-18(11-19)9-12(20)5-6-13(16)18/h13-14H,4-10H2,1-3H3/t13-,14-,16-,17+,18-/m1/s1 |
| InChIKey | UBRWIHMOPUJGDJ-HUMVNOLHSA-N |
| XLogP | 3.25 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |