C12H19ClN2O3S — CID 119440105
N-[2-(ethylaminomethyl)phenyl]-2-methylsulfonylacetamide;hydrochloride (PubChem CID 119440105) has the molecular formula C12H19ClN2O3S and a molecular weight of 306.81 g/mol. Its IUPAC name is N-[2-(ethylaminomethyl)phenyl]-2-methylsulfonylacetamide;hydrochloride.
| Compound Name | N-[2-(ethylaminomethyl)phenyl]-2-methylsulfonylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119440105 |
| Molecular Formula | C12H19ClN2O3S |
| Molecular Weight | 306.81 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | N-[2-(ethylaminomethyl)phenyl]-2-methylsulfonylacetamide;hydrochloride |
| SMILES | CCNCc1ccccc1NC(=O)CS(C)(=O)=O.Cl |
| InChI | InChI=1S/C12H18N2O3S.ClH/c1-3-13-8-10-6-4-5-7-11(10)14-12(15)9-18(2,16)17;/h4-7,13H,3,8-9H2,1-2H3,(H,14,15);1H |
| InChIKey | KJWLUNWIWDWHEP-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.81 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |