C24H33ClN2O2 — CID 119441295
4-[(4-tert-butylphenoxy)methyl]-N-methyl-N-piperidin-4-ylbenzamide;hydrochloride (PubChem CID 119441295) has the molecular formula C24H33ClN2O2 and a molecular weight of 416.99 g/mol. Its IUPAC name is 4-[(4-tert-butylphenoxy)methyl]-N-methyl-N-piperidin-4-ylbenzamide;hydrochloride.
| Compound Name | 4-[(4-tert-butylphenoxy)methyl]-N-methyl-N-piperidin-4-ylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119441295 |
| Molecular Formula | C24H33ClN2O2 |
| Molecular Weight | 416.99 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 4-[(4-tert-butylphenoxy)methyl]-N-methyl-N-piperidin-4-ylbenzamide;hydrochloride |
| SMILES | CN(C(=O)c1ccc(COc2ccc(C(C)(C)C)cc2)cc1)C1CCNCC1.Cl |
| InChI | InChI=1S/C24H32N2O2.ClH/c1-24(2,3)20-9-11-22(12-10-20)28-17-18-5-7-19(8-6-18)23(27)26(4)21-13-15-25-16-14-21;/h5-12,21,25H,13-17H2,1-4H3;1H |
| InChIKey | PRYLMKGYUKDBAI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.99 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |