C14H22ClN3O3 — CID 119441351
N-[1-[methyl(piperidin-4-yl)amino]-1-oxopropan-2-yl]furan-3-carboxamide;hydrochloride (PubChem CID 119441351) has the molecular formula C14H22ClN3O3 and a molecular weight of 315.80 g/mol. Its IUPAC name is N-[1-[methyl(piperidin-4-yl)amino]-1-oxopropan-2-yl]furan-3-carboxamide;hydrochloride.
| Compound Name | N-[1-[methyl(piperidin-4-yl)amino]-1-oxopropan-2-yl]furan-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119441351 |
| Molecular Formula | C14H22ClN3O3 |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | N-[1-[methyl(piperidin-4-yl)amino]-1-oxopropan-2-yl]furan-3-carboxamide;hydrochloride |
| SMILES | CC(NC(=O)c1ccoc1)C(=O)N(C)C1CCNCC1.Cl |
| InChI | InChI=1S/C14H21N3O3.ClH/c1-10(16-13(18)11-5-8-20-9-11)14(19)17(2)12-3-6-15-7-4-12;/h5,8-10,12,15H,3-4,6-7H2,1-2H3,(H,16,18);1H |
| InChIKey | UPEJOUNGNZXJIA-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |