C18H26N2O2S2 — CID 119441718
2-[4-(1,3-dithian-2-yl)phenoxy]-N-methyl-N-piperidin-4-ylacetamide (PubChem CID 119441718) has the molecular formula C18H26N2O2S2 and a molecular weight of 366.55 g/mol. Its IUPAC name is 2-[4-(1,3-dithian-2-yl)phenoxy]-N-methyl-N-piperidin-4-ylacetamide.
| Compound Name | 2-[4-(1,3-dithian-2-yl)phenoxy]-N-methyl-N-piperidin-4-ylacetamide |
|---|---|
| PubChem CID | 119441718 |
| Molecular Formula | C18H26N2O2S2 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 2-[4-(1,3-dithian-2-yl)phenoxy]-N-methyl-N-piperidin-4-ylacetamide |
| SMILES | CN(C(=O)COc1ccc(C2SCCCS2)cc1)C1CCNCC1 |
| InChI | InChI=1S/C18H26N2O2S2/c1-20(15-7-9-19-10-8-15)17(21)13-22-16-5-3-14(4-6-16)18-23-11-2-12-24-18/h3-6,15,18-19H,2,7-13H2,1H3 |
| InChIKey | PTUXZBOXLPETEH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |