About N'-methyl-N'-piperidin-4-yl-N-propan-2-ylpentanediamide
N'-methyl-N'-piperidin-4-yl-N-propan-2-ylpentanediamide (PubChem CID 119442340) has the molecular formula C14H27N3O2
and a molecular weight of 269.39 g/mol. Its IUPAC name is N'-methyl-N'-piperidin-4-yl-N-propan-2-ylpentanediamide.
Molecular Properties
| Compound Name | N'-methyl-N'-piperidin-4-yl-N-propan-2-ylpentanediamide |
| PubChem CID | 119442340 |
| Molecular Formula | C14H27N3O2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | N'-methyl-N'-piperidin-4-yl-N-propan-2-ylpentanediamide |
| SMILES | CC(C)NC(=O)CCCC(=O)N(C)C1CCNCC1 |
| InChI | InChI=1S/C14H27N3O2/c1-11(2)16-13(18)5-4-6-14(19)17(3)12-7-9-15-10-8-12/h11-12,15H,4-10H2,1-3H3,(H,16,18) |
| InChIKey | TYKVUJMIUQDEGR-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-methyl-N'-piperidin-4-yl-N-propan-2-ylpentanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N'-piperidin-4-yl-N-propan-2-ylpentanediamide?
The IUPAC name of N'-methyl-N'-piperidin-4-yl-N-propan-2-ylpentanediamide (CID 119442340) is N'-methyl-N'-piperidin-4-yl-N-propan-2-ylpentanediamide.
What is the SMILES notation for N'-methyl-N'-piperidin-4-yl-N-propan-2-ylpentanediamide?
The canonical SMILES for N'-methyl-N'-piperidin-4-yl-N-propan-2-ylpentanediamide is CC(C)NC(=O)CCCC(=O)N(C)C1CCNCC1.
What is the InChIKey of N'-methyl-N'-piperidin-4-yl-N-propan-2-ylpentanediamide?
The InChIKey is TYKVUJMIUQDEGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N3O2/c1-11(2)16-13(18)5-4-6-14(19)17(3)12-7-9-15-10-8-12/h11-12,15H,4-10H2,1-3H3,(H,16,18).
What are the key properties of N'-methyl-N'-piperidin-4-yl-N-propan-2-ylpentanediamide?
N'-methyl-N'-piperidin-4-yl-N-propan-2-ylpentanediamide has a molecular weight of 269.39 g/mol, XLogP of 0.89, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N'-piperidin-4-yl-N-propan-2-ylpentanediamide is sourced from PubChem (CID 119442340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).