C15H16F6N2O — CID 119442576
N-methyl-N-piperidin-4-yl-3,5-bis(trifluoromethyl)benzamide (PubChem CID 119442576) has the molecular formula C15H16F6N2O and a molecular weight of 354.29 g/mol. Its IUPAC name is N-methyl-N-piperidin-4-yl-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-methyl-N-piperidin-4-yl-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 119442576 |
| Molecular Formula | C15H16F6N2O |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N-methyl-N-piperidin-4-yl-3,5-bis(trifluoromethyl)benzamide |
| SMILES | CN(C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C1CCNCC1 |
| InChI | InChI=1S/C15H16F6N2O/c1-23(12-2-4-22-5-3-12)13(24)9-6-10(14(16,17)18)8-11(7-9)15(19,20)21/h6-8,12,22H,2-5H2,1H3 |
| InChIKey | MWSKSBWXMSZYCB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |