C14H26N4O3 — CID 119444938
1-(2-methoxyethyl)-5-oxo-N-(2-piperazin-1-ylethyl)pyrrolidine-3-carboxamide (PubChem CID 119444938) has the molecular formula C14H26N4O3 and a molecular weight of 298.39 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-5-oxo-N-(2-piperazin-1-ylethyl)pyrrolidine-3-carboxamide.
| Compound Name | 1-(2-methoxyethyl)-5-oxo-N-(2-piperazin-1-ylethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 119444938 |
| Molecular Formula | C14H26N4O3 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 1-(2-methoxyethyl)-5-oxo-N-(2-piperazin-1-ylethyl)pyrrolidine-3-carboxamide |
| SMILES | COCCN1CC(C(=O)NCCN2CCNCC2)CC1=O |
| InChI | InChI=1S/C14H26N4O3/c1-21-9-8-18-11-12(10-13(18)19)14(20)16-4-7-17-5-2-15-3-6-17/h12,15H,2-11H2,1H3,(H,16,20) |
| InChIKey | WVVHLNPGIOCDGF-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |