C10H12Cl4 — CID 11944740
(1S,3S,5R,7R)-4,4,8,8-tetrachloro-1,5-dimethyltricyclo[5.1.0.03,5]octane (PubChem CID 11944740) has the molecular formula C10H12Cl4 and a molecular weight of 274.02 g/mol. Its IUPAC name is (1S,3S,5R,7R)-4,4,8,8-tetrachloro-1,5-dimethyltricyclo[5.1.0.03,5]octane.
| Compound Name | (1S,3S,5R,7R)-4,4,8,8-tetrachloro-1,5-dimethyltricyclo[5.1.0.03,5]octane |
|---|---|
| PubChem CID | 11944740 |
| Molecular Formula | C10H12Cl4 |
| Molecular Weight | 274.02 g/mol |
| Exact Mass | 271.97 |
| IUPAC Name | (1S,3S,5R,7R)-4,4,8,8-tetrachloro-1,5-dimethyltricyclo[5.1.0.03,5]octane |
| SMILES | C[C@]12C[C@@H]3C(Cl)(Cl)[C@]3(C)C[C@H]1C2(Cl)Cl |
| InChI | InChI=1S/C10H12Cl4/c1-7-3-6-8(2,10(6,13)14)4-5(7)9(7,11)12/h5-6H,3-4H2,1-2H3/t5-,6+,7+,8- |
| InChIKey | RIRMAOGFIHWDND-SOSBWXJGSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.02 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|