C36H26 — CID 11944764
(1S,2S,2aR,10bR)-1,2-dinaphthalen-2-yl-1,2,2a,10b-tetrahydrocyclobuta[l]phenanthrene (PubChem CID 11944764) has the molecular formula C36H26 and a molecular weight of 458.60 g/mol. Its IUPAC name is (1S,2S,2aR,10bR)-1,2-dinaphthalen-2-yl-1,2,2a,10b-tetrahydrocyclobuta[l]phenanthrene.
| Compound Name | (1S,2S,2aR,10bR)-1,2-dinaphthalen-2-yl-1,2,2a,10b-tetrahydrocyclobuta[l]phenanthrene |
|---|---|
| PubChem CID | 11944764 |
| Molecular Formula | C36H26 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | (1S,2S,2aR,10bR)-1,2-dinaphthalen-2-yl-1,2,2a,10b-tetrahydrocyclobuta[l]phenanthrene |
| SMILES | c1ccc2c(c1)-c1ccccc1[C@@H]1[C@@H](c3ccc4ccccc4c3)[C@H](c3ccc4ccccc4c3)[C@@H]21 |
| InChI | InChI=1S/C36H26/c1-3-11-25-21-27(19-17-23(25)9-1)33-34(28-20-18-24-10-2-4-12-26(24)22-28)36-32-16-8-6-14-30(32)29-13-5-7-15-31(29)35(33)36/h1-22,33-36H/t33-,34-,35+,36+/m0/s1 |
| InChIKey | QYLYTMLNMITGTH-CLLHQPRTSA-N |
| XLogP | 9.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |