C8H8O5S — CID 11944766
(1S,6S,7R)-9,9-dioxo-4-oxa-9λ6-thiatricyclo[5.3.0.02,6]decane-3,5-dione (PubChem CID 11944766) has the molecular formula C8H8O5S and a molecular weight of 216.21 g/mol. Its IUPAC name is (1S,6S,7R)-9,9-dioxo-4-oxa-9λ6-thiatricyclo[5.3.0.02,6]decane-3,5-dione.
| Compound Name | (1S,6S,7R)-9,9-dioxo-4-oxa-9λ6-thiatricyclo[5.3.0.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 11944766 |
| Molecular Formula | C8H8O5S |
| Molecular Weight | 216.21 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | (1S,6S,7R)-9,9-dioxo-4-oxa-9λ6-thiatricyclo[5.3.0.02,6]decane-3,5-dione |
| SMILES | O=C1OC(=O)[C@H]2C1[C@@H]1CS(=O)(=O)C[C@@H]12 |
| InChI | InChI=1S/C8H8O5S/c9-7-5-3-1-14(11,12)2-4(3)6(5)8(10)13-7/h3-6H,1-2H2/t3-,4+,5+,6?/m0/s1 |
| InChIKey | XDMVLZSXVDCDKD-JMSAOHGTSA-N |
| XLogP | -1.02 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.21 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|