C18H28N4O2 — CID 119448601
2-(2,2-dimethylpropanoylamino)-N-(2-piperazin-1-ylethyl)benzamide (PubChem CID 119448601) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 2-(2,2-dimethylpropanoylamino)-N-(2-piperazin-1-ylethyl)benzamide.
| Compound Name | 2-(2,2-dimethylpropanoylamino)-N-(2-piperazin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 119448601 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 2-(2,2-dimethylpropanoylamino)-N-(2-piperazin-1-ylethyl)benzamide |
| SMILES | CC(C)(C)C(=O)Nc1ccccc1C(=O)NCCN1CCNCC1 |
| InChI | InChI=1S/C18H28N4O2/c1-18(2,3)17(24)21-15-7-5-4-6-14(15)16(23)20-10-13-22-11-8-19-9-12-22/h4-7,19H,8-13H2,1-3H3,(H,20,23)(H,21,24) |
| InChIKey | RIBHCKJXYIEFMJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |