C18H19BrN2O2 — CID 119449633
3-[(2-bromophenyl)methoxy]-N-pyrrolidin-3-ylbenzamide (PubChem CID 119449633) has the molecular formula C18H19BrN2O2 and a molecular weight of 375.27 g/mol. Its IUPAC name is 3-[(2-bromophenyl)methoxy]-N-pyrrolidin-3-ylbenzamide.
| Compound Name | 3-[(2-bromophenyl)methoxy]-N-pyrrolidin-3-ylbenzamide |
|---|---|
| PubChem CID | 119449633 |
| Molecular Formula | C18H19BrN2O2 |
| Molecular Weight | 375.27 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 3-[(2-bromophenyl)methoxy]-N-pyrrolidin-3-ylbenzamide |
| SMILES | O=C(NC1CCNC1)c1cccc(OCc2ccccc2Br)c1 |
| InChI | InChI=1S/C18H19BrN2O2/c19-17-7-2-1-4-14(17)12-23-16-6-3-5-13(10-16)18(22)21-15-8-9-20-11-15/h1-7,10,15,20H,8-9,11-12H2,(H,21,22) |
| InChIKey | LVPWFRLYQSZJFD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.27 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |