C10H8Cl6 — CID 11945003
(1S,2S,4R,5S,7R,9S)-3,3,6,6,10,10-hexachlorotetracyclo[7.1.0.02,4.05,7]decane (PubChem CID 11945003) has the molecular formula C10H8Cl6 and a molecular weight of 340.89 g/mol. Its IUPAC name is (1S,2S,4R,5S,7R,9S)-3,3,6,6,10,10-hexachlorotetracyclo[7.1.0.02,4.05,7]decane.
| Compound Name | (1S,2S,4R,5S,7R,9S)-3,3,6,6,10,10-hexachlorotetracyclo[7.1.0.02,4.05,7]decane |
|---|---|
| PubChem CID | 11945003 |
| Molecular Formula | C10H8Cl6 |
| Molecular Weight | 340.89 g/mol |
| Exact Mass | 337.88 |
| IUPAC Name | (1S,2S,4R,5S,7R,9S)-3,3,6,6,10,10-hexachlorotetracyclo[7.1.0.02,4.05,7]decane |
| SMILES | ClC1(Cl)[C@@H]2[C@H]1[C@@H]1[C@H](C[C@@H]3[C@@H]2C3(Cl)Cl)C1(Cl)Cl |
| InChI | InChI=1S/C10H8Cl6/c11-8(12)2-1-3-5(9(3,13)14)7-6(4(2)8)10(7,15)16/h2-7H,1H2/t2-,3+,4-,5-,6+,7-/m0/s1 |
| InChIKey | LXFGXVWBHKKGFX-IFGBLCKLSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.89 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|