C28H45O5- — CID 11945066
(1R,3aS,4R,5S,7aR)-5-[(1R,4S)-4-acetyloxy-1-methyl-2-oxocyclohexyl]-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroindene-4-carboxylate (PubChem CID 11945066) has the molecular formula C28H45O5- and a molecular weight of 461.66 g/mol. Its IUPAC name is (1R,3aS,4R,5S,7aR)-5-[(1R,4S)-4-acetyloxy-1-methyl-2-oxocyclohexyl]-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroindene-4-carboxylate.
| Compound Name | (1R,3aS,4R,5S,7aR)-5-[(1R,4S)-4-acetyloxy-1-methyl-2-oxocyclohexyl]-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroindene-4-carboxylate |
|---|---|
| PubChem CID | 11945066 |
| Molecular Formula | C28H45O5- |
| Molecular Weight | 461.66 g/mol |
| Exact Mass | 461.33 |
| IUPAC Name | (1R,3aS,4R,5S,7aR)-5-[(1R,4S)-4-acetyloxy-1-methyl-2-oxocyclohexyl]-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroindene-4-carboxylate |
| SMILES | CC(=O)O[C@H]1CC[C@](C)([C@H]2CC[C@]3(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@H]3[C@H]2C(=O)[O-])C(=O)C1 |
| InChI | InChI=1S/C28H46O5/c1-17(2)8-7-9-18(3)21-10-11-22-25(26(31)32)23(13-15-27(21,22)5)28(6)14-12-20(16-24(28)30)33-19(4)29/h17-18,20-23,25H,7-16H2,1-6H3,(H,31,32)/p-1/t18-,20+,21-,22+,23+,25-,27-,28-/m1/s1 |
| InChIKey | XAJFPZPUIZSONS-PJGWRJOPSA-M |
| XLogP | 4.95 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.66 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |