About 2-(2,6-difluorophenyl)-N-pyrrolidin-3-ylcyclopropane-1-carboxamide;hydrochloride
2-(2,6-difluorophenyl)-N-pyrrolidin-3-ylcyclopropane-1-carboxamide;hydrochloride (PubChem CID 119451294) has the molecular formula C14H17ClF2N2O
and a molecular weight of 302.75 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-N-pyrrolidin-3-ylcyclopropane-1-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | 2-(2,6-difluorophenyl)-N-pyrrolidin-3-ylcyclopropane-1-carboxamide;hydrochloride |
| PubChem CID | 119451294 |
| Molecular Formula | C14H17ClF2N2O |
| Molecular Weight | 302.75 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 2-(2,6-difluorophenyl)-N-pyrrolidin-3-ylcyclopropane-1-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NC1CCNC1)C1CC1c1c(F)cccc1F |
| InChI | InChI=1S/C14H16F2N2O.ClH/c15-11-2-1-3-12(16)13(11)9-6-10(9)14(19)18-8-4-5-17-7-8;/h1-3,8-10,17H,4-7H2,(H,18,19);1H |
| InChIKey | LYTKALDZRPTXMK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.75 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2,6-difluorophenyl)-N-pyrrolidin-3-ylcyclopropane-1-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-difluorophenyl)-N-pyrrolidin-3-ylcyclopropane-1-carboxamide;hydrochloride?
The IUPAC name of 2-(2,6-difluorophenyl)-N-pyrrolidin-3-ylcyclopropane-1-carboxamide;hydrochloride (CID 119451294) is 2-(2,6-difluorophenyl)-N-pyrrolidin-3-ylcyclopropane-1-carboxamide;hydrochloride.
What is the SMILES notation for 2-(2,6-difluorophenyl)-N-pyrrolidin-3-ylcyclopropane-1-carboxamide;hydrochloride?
The canonical SMILES for 2-(2,6-difluorophenyl)-N-pyrrolidin-3-ylcyclopropane-1-carboxamide;hydrochloride is Cl.O=C(NC1CCNC1)C1CC1c1c(F)cccc1F.
What is the InChIKey of 2-(2,6-difluorophenyl)-N-pyrrolidin-3-ylcyclopropane-1-carboxamide;hydrochloride?
The InChIKey is LYTKALDZRPTXMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16F2N2O.ClH/c15-11-2-1-3-12(16)13(11)9-6-10(9)14(19)18-8-4-5-17-7-8;/h1-3,8-10,17H,4-7H2,(H,18,19);1H.
What are the key properties of 2-(2,6-difluorophenyl)-N-pyrrolidin-3-ylcyclopropane-1-carboxamide;hydrochloride?
2-(2,6-difluorophenyl)-N-pyrrolidin-3-ylcyclopropane-1-carboxamide;hydrochloride has a molecular weight of 302.75 g/mol, XLogP of 1.97, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-difluorophenyl)-N-pyrrolidin-3-ylcyclopropane-1-carboxamide;hydrochloride is sourced from PubChem (CID 119451294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).