C20H21N3O7 — CID 11945494
[2-(3-nitroanilino)-2-oxoethyl] (2S)-2-[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]propanoate (PubChem CID 11945494) has the molecular formula C20H21N3O7 and a molecular weight of 415.40 g/mol. Its IUPAC name is [2-(3-nitroanilino)-2-oxoethyl] (2S)-2-[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]propanoate.
| Compound Name | [2-(3-nitroanilino)-2-oxoethyl] (2S)-2-[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]propanoate |
|---|---|
| PubChem CID | 11945494 |
| Molecular Formula | C20H21N3O7 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | [2-(3-nitroanilino)-2-oxoethyl] (2S)-2-[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]propanoate |
| SMILES | C[C@@H](C(=O)OCC(=O)Nc1cccc([N+](=O)[O-])c1)N1C(=O)[C@@H]2[C@@H]3CC[C@@H](C3)[C@@H]2C1=O |
| InChI | InChI=1S/C20H21N3O7/c1-10(22-18(25)16-11-5-6-12(7-11)17(16)19(22)26)20(27)30-9-15(24)21-13-3-2-4-14(8-13)23(28)29/h2-4,8,10-12,16-17H,5-7,9H2,1H3,(H,21,24)/t10-,11-,12+,16-,17+/m0/s1 |
| InChIKey | UILMECJHSVGHRG-YTUFUYLDSA-N |
| XLogP | 1.50 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|