C12H23ClN2OS — CID 119456893
N-(8-azabicyclo[3.2.1]octan-3-yl)-2-propylsulfanylacetamide;hydrochloride (PubChem CID 119456893) has the molecular formula C12H23ClN2OS and a molecular weight of 278.85 g/mol. Its IUPAC name is N-(8-azabicyclo[3.2.1]octan-3-yl)-2-propylsulfanylacetamide;hydrochloride.
| Compound Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-2-propylsulfanylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119456893 |
| Molecular Formula | C12H23ClN2OS |
| Molecular Weight | 278.85 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-2-propylsulfanylacetamide;hydrochloride |
| SMILES | CCCSCC(=O)NC1CC2CCC(C1)N2.Cl |
| InChI | InChI=1S/C12H22N2OS.ClH/c1-2-5-16-8-12(15)14-11-6-9-3-4-10(7-11)13-9;/h9-11,13H,2-8H2,1H3,(H,14,15);1H |
| InChIKey | HNSXAGXPPVGHFK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.85 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|