C21H25Cl2N5O — CID 119459838
1-phenyl-N-(piperidin-3-ylmethyl)-3-pyridin-3-ylpyrazole-4-carboxamide;dihydrochloride (PubChem CID 119459838) has the molecular formula C21H25Cl2N5O and a molecular weight of 434.37 g/mol. Its IUPAC name is 1-phenyl-N-(piperidin-3-ylmethyl)-3-pyridin-3-ylpyrazole-4-carboxamide;dihydrochloride.
| Compound Name | 1-phenyl-N-(piperidin-3-ylmethyl)-3-pyridin-3-ylpyrazole-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119459838 |
| Molecular Formula | C21H25Cl2N5O |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 1-phenyl-N-(piperidin-3-ylmethyl)-3-pyridin-3-ylpyrazole-4-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCC1CCCNC1)c1cn(-c2ccccc2)nc1-c1cccnc1 |
| InChI | InChI=1S/C21H23N5O.2ClH/c27-21(24-13-16-6-4-10-22-12-16)19-15-26(18-8-2-1-3-9-18)25-20(19)17-7-5-11-23-14-17;;/h1-3,5,7-9,11,14-16,22H,4,6,10,12-13H2,(H,24,27);2*1H |
| InChIKey | ZBFFABXLQIAZJK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |