C17H25ClN2O2 — CID 119462344
4-(4-methylphenyl)-4-oxo-N-(piperidin-3-ylmethyl)butanamide;hydrochloride (PubChem CID 119462344) has the molecular formula C17H25ClN2O2 and a molecular weight of 324.85 g/mol. Its IUPAC name is 4-(4-methylphenyl)-4-oxo-N-(piperidin-3-ylmethyl)butanamide;hydrochloride.
| Compound Name | 4-(4-methylphenyl)-4-oxo-N-(piperidin-3-ylmethyl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119462344 |
| Molecular Formula | C17H25ClN2O2 |
| Molecular Weight | 324.85 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 4-(4-methylphenyl)-4-oxo-N-(piperidin-3-ylmethyl)butanamide;hydrochloride |
| SMILES | Cc1ccc(C(=O)CCC(=O)NCC2CCCNC2)cc1.Cl |
| InChI | InChI=1S/C17H24N2O2.ClH/c1-13-4-6-15(7-5-13)16(20)8-9-17(21)19-12-14-3-2-10-18-11-14;/h4-7,14,18H,2-3,8-12H2,1H3,(H,19,21);1H |
| InChIKey | GZSHAMFPLWMDPM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.85 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |