C17H26N2O3 — CID 119464205
3-(3,4-dimethoxyphenyl)-N-(piperidin-3-ylmethyl)propanamide (PubChem CID 119464205) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-(piperidin-3-ylmethyl)propanamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-(piperidin-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 119464205 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-(piperidin-3-ylmethyl)propanamide |
| SMILES | COc1ccc(CCC(=O)NCC2CCCNC2)cc1OC |
| InChI | InChI=1S/C17H26N2O3/c1-21-15-7-5-13(10-16(15)22-2)6-8-17(20)19-12-14-4-3-9-18-11-14/h5,7,10,14,18H,3-4,6,8-9,11-12H2,1-2H3,(H,19,20) |
| InChIKey | ARBCFIDZBBSBMR-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |