C13H16IN3O3 — CID 119464595
2-iodo-4-nitro-N-(piperidin-3-ylmethyl)benzamide (PubChem CID 119464595) has the molecular formula C13H16IN3O3 and a molecular weight of 389.19 g/mol. Its IUPAC name is 2-iodo-4-nitro-N-(piperidin-3-ylmethyl)benzamide.
| Compound Name | 2-iodo-4-nitro-N-(piperidin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 119464595 |
| Molecular Formula | C13H16IN3O3 |
| Molecular Weight | 389.19 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | 2-iodo-4-nitro-N-(piperidin-3-ylmethyl)benzamide |
| SMILES | O=C(NCC1CCCNC1)c1ccc([N+](=O)[O-])cc1I |
| InChI | InChI=1S/C13H16IN3O3/c14-12-6-10(17(19)20)3-4-11(12)13(18)16-8-9-2-1-5-15-7-9/h3-4,6,9,15H,1-2,5,7-8H2,(H,16,18) |
| InChIKey | IMNKUUROKFFVFW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.19 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|