C21H16IN4O+ — CID 11946701
(2R,3R,10bS)-1,1-dicyano-2-(3-iodophenyl)-2,3,4,10b-tetrahydropyrrolo[2,1-a]isoquinolin-4-ium-3-carboxamide (PubChem CID 11946701) has the molecular formula C21H16IN4O+ and a molecular weight of 467.29 g/mol. Its IUPAC name is (2R,3R,10bS)-1,1-dicyano-2-(3-iodophenyl)-2,3,4,10b-tetrahydropyrrolo[2,1-a]isoquinolin-4-ium-3-carboxamide.
| Compound Name | (2R,3R,10bS)-1,1-dicyano-2-(3-iodophenyl)-2,3,4,10b-tetrahydropyrrolo[2,1-a]isoquinolin-4-ium-3-carboxamide |
|---|---|
| PubChem CID | 11946701 |
| Molecular Formula | C21H16IN4O+ |
| Molecular Weight | 467.29 g/mol |
| Exact Mass | 467.04 |
| IUPAC Name | (2R,3R,10bS)-1,1-dicyano-2-(3-iodophenyl)-2,3,4,10b-tetrahydropyrrolo[2,1-a]isoquinolin-4-ium-3-carboxamide |
| SMILES | N#CC1(C#N)[C@@H]2c3ccccc3C=C[NH+]2[C@@H](C(N)=O)[C@@H]1c1cccc(I)c1 |
| InChI | InChI=1S/C21H15IN4O/c22-15-6-3-5-14(10-15)17-18(20(25)27)26-9-8-13-4-1-2-7-16(13)19(26)21(17,11-23)12-24/h1-10,17-19H,(H2,25,27)/p+1/t17-,18+,19-/m0/s1 |
| InChIKey | WAPYYTNVDLAESG-OTWHNJEPSA-O |
| XLogP | 1.89 |
| TPSA | 95.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|