C14H20ClN3O4 — CID 119467805
[2-(aminomethyl)piperidin-1-yl]-(3-methoxy-4-nitrophenyl)methanone;hydrochloride (PubChem CID 119467805) has the molecular formula C14H20ClN3O4 and a molecular weight of 329.78 g/mol. Its IUPAC name is [2-(aminomethyl)piperidin-1-yl]-(3-methoxy-4-nitrophenyl)methanone;hydrochloride.
| Compound Name | [2-(aminomethyl)piperidin-1-yl]-(3-methoxy-4-nitrophenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119467805 |
| Molecular Formula | C14H20ClN3O4 |
| Molecular Weight | 329.78 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | [2-(aminomethyl)piperidin-1-yl]-(3-methoxy-4-nitrophenyl)methanone;hydrochloride |
| SMILES | COc1cc(C(=O)N2CCCCC2CN)ccc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C14H19N3O4.ClH/c1-21-13-8-10(5-6-12(13)17(19)20)14(18)16-7-3-2-4-11(16)9-15;/h5-6,8,11H,2-4,7,9,15H2,1H3;1H |
| InChIKey | BKWYNHNCDMSABE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.78 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|