C35H26Br2Cl3NO4 — CID 11946846
ethyl (1S,2R,3R,4R,6R)-3-(4-bromobenzoyl)-4-(4-bromophenyl)-2-(4-chlorophenyl)-1-cyano-6-(2,4-dichlorophenyl)-4-hydroxycyclohexane-1-carboxylate (PubChem CID 11946846) has the molecular formula C35H26Br2Cl3NO4 and a molecular weight of 790.76 g/mol. Its IUPAC name is ethyl (1S,2R,3R,4R,6R)-3-(4-bromobenzoyl)-4-(4-bromophenyl)-2-(4-chlorophenyl)-1-cyano-6-(2,4-dichlorophenyl)-4-hydroxycyclohexane-1-carboxylate.
| Compound Name | ethyl (1S,2R,3R,4R,6R)-3-(4-bromobenzoyl)-4-(4-bromophenyl)-2-(4-chlorophenyl)-1-cyano-6-(2,4-dichlorophenyl)-4-hydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 11946846 |
| Molecular Formula | C35H26Br2Cl3NO4 |
| Molecular Weight | 790.76 g/mol |
| Exact Mass | 786.93 |
| IUPAC Name | ethyl (1S,2R,3R,4R,6R)-3-(4-bromobenzoyl)-4-(4-bromophenyl)-2-(4-chlorophenyl)-1-cyano-6-(2,4-dichlorophenyl)-4-hydroxycyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C#N)[C@H](c2ccc(Cl)cc2Cl)C[C@](O)(c2ccc(Br)cc2)[C@H](C(=O)c2ccc(Br)cc2)[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C35H26Br2Cl3NO4/c1-2-45-33(43)34(19-41)28(27-16-15-26(39)17-29(27)40)18-35(44,22-7-11-24(37)12-8-22)31(30(34)20-5-13-25(38)14-6-20)32(42)21-3-9-23(36)10-4-21/h3-17,28,30-31,44H,2,18H2,1H3/t28-,30-,31-,34-,35-/m0/s1 |
| InChIKey | GNUAFQNRAAFJAY-OITDHTSDSA-N |
| XLogP | 9.90 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.76 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |