C18H20ClN3O2S — CID 119468501
N-[5-[2-(aminomethyl)piperidine-1-carbonyl]-2-chlorophenyl]thiophene-2-carboxamide (PubChem CID 119468501) has the molecular formula C18H20ClN3O2S and a molecular weight of 377.90 g/mol. Its IUPAC name is N-[5-[2-(aminomethyl)piperidine-1-carbonyl]-2-chlorophenyl]thiophene-2-carboxamide.
| Compound Name | N-[5-[2-(aminomethyl)piperidine-1-carbonyl]-2-chlorophenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 119468501 |
| Molecular Formula | C18H20ClN3O2S |
| Molecular Weight | 377.90 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | N-[5-[2-(aminomethyl)piperidine-1-carbonyl]-2-chlorophenyl]thiophene-2-carboxamide |
| SMILES | NCC1CCCCN1C(=O)c1ccc(Cl)c(NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C18H20ClN3O2S/c19-14-7-6-12(18(24)22-8-2-1-4-13(22)11-20)10-15(14)21-17(23)16-5-3-9-25-16/h3,5-7,9-10,13H,1-2,4,8,11,20H2,(H,21,23) |
| InChIKey | ZGKHDZVVAWJCID-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.90 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |