C37H33Cl2NO4 — CID 11946864
ethyl (1S,2R,3R,4R,6R)-3-(4-chlorobenzoyl)-4-(4-chlorophenyl)-1-cyano-4-hydroxy-2,6-bis(2-methylphenyl)cyclohexane-1-carboxylate (PubChem CID 11946864) has the molecular formula C37H33Cl2NO4 and a molecular weight of 626.58 g/mol. Its IUPAC name is ethyl (1S,2R,3R,4R,6R)-3-(4-chlorobenzoyl)-4-(4-chlorophenyl)-1-cyano-4-hydroxy-2,6-bis(2-methylphenyl)cyclohexane-1-carboxylate.
| Compound Name | ethyl (1S,2R,3R,4R,6R)-3-(4-chlorobenzoyl)-4-(4-chlorophenyl)-1-cyano-4-hydroxy-2,6-bis(2-methylphenyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 11946864 |
| Molecular Formula | C37H33Cl2NO4 |
| Molecular Weight | 626.58 g/mol |
| Exact Mass | 625.18 |
| IUPAC Name | ethyl (1S,2R,3R,4R,6R)-3-(4-chlorobenzoyl)-4-(4-chlorophenyl)-1-cyano-4-hydroxy-2,6-bis(2-methylphenyl)cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C#N)[C@@H](c2ccccc2C)C[C@](O)(c2ccc(Cl)cc2)[C@H](C(=O)c2ccc(Cl)cc2)[C@@H]1c1ccccc1C |
| InChI | InChI=1S/C37H33Cl2NO4/c1-4-44-35(42)36(22-40)31(29-11-7-5-9-23(29)2)21-37(43,26-15-19-28(39)20-16-26)33(32(36)30-12-8-6-10-24(30)3)34(41)25-13-17-27(38)18-14-25/h5-20,31-33,43H,4,21H2,1-3H3/t31-,32+,33+,36+,37+/m1/s1 |
| InChIKey | JFLNVJYZFUGLFX-HVHRWFTHSA-N |
| XLogP | 8.34 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.58 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |