C25H24N2O3 — CID 11947205
N-(3,4-dimethylphenyl)-2-[(1S,2S,6S,7S)-8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzamide (PubChem CID 11947205) has the molecular formula C25H24N2O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-[(1S,2S,6S,7S)-8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-[(1S,2S,6S,7S)-8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzamide |
|---|---|
| PubChem CID | 11947205 |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-[(1S,2S,6S,7S)-8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzamide |
| SMILES | CC1=C[C@@H]2C[C@H]1[C@@H]1C(=O)N(c3ccccc3C(=O)Nc3ccc(C)c(C)c3)C(=O)[C@H]12 |
| InChI | InChI=1S/C25H24N2O3/c1-13-8-9-17(11-14(13)2)26-23(28)18-6-4-5-7-20(18)27-24(29)21-16-10-15(3)19(12-16)22(21)25(27)30/h4-11,16,19,21-22H,12H2,1-3H3,(H,26,28)/t16-,19-,21+,22+/m1/s1 |
| InChIKey | SOUBZJRBEHJTPV-MWRLGJARSA-N |
| XLogP | 4.26 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|