C17H19BrN2O3 — CID 119472053
[5-[(4-bromophenoxy)methyl]furan-2-yl]-(2-methylpiperazin-1-yl)methanone (PubChem CID 119472053) has the molecular formula C17H19BrN2O3 and a molecular weight of 379.25 g/mol. Its IUPAC name is [5-[(4-bromophenoxy)methyl]furan-2-yl]-(2-methylpiperazin-1-yl)methanone.
| Compound Name | [5-[(4-bromophenoxy)methyl]furan-2-yl]-(2-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 119472053 |
| Molecular Formula | C17H19BrN2O3 |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | [5-[(4-bromophenoxy)methyl]furan-2-yl]-(2-methylpiperazin-1-yl)methanone |
| SMILES | CC1CNCCN1C(=O)c1ccc(COc2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C17H19BrN2O3/c1-12-10-19-8-9-20(12)17(21)16-7-6-15(23-16)11-22-14-4-2-13(18)3-5-14/h2-7,12,19H,8-11H2,1H3 |
| InChIKey | YEXJFTRETTUPFD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |