C14H21N3O4S — CID 119472443
2-methoxy-N-methyl-5-(2-methylpiperazine-1-carbonyl)benzenesulfonamide (PubChem CID 119472443) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is 2-methoxy-N-methyl-5-(2-methylpiperazine-1-carbonyl)benzenesulfonamide.
| Compound Name | 2-methoxy-N-methyl-5-(2-methylpiperazine-1-carbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 119472443 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 2-methoxy-N-methyl-5-(2-methylpiperazine-1-carbonyl)benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cc(C(=O)N2CCNCC2C)ccc1OC |
| InChI | InChI=1S/C14H21N3O4S/c1-10-9-16-6-7-17(10)14(18)11-4-5-12(21-3)13(8-11)22(19,20)15-2/h4-5,8,10,15-16H,6-7,9H2,1-3H3 |
| InChIKey | UOLMTVDMGAFHJL-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |