C11H17Cl2N3O — CID 119473354
(4-chloro-1-methylpyrrol-2-yl)-(2-methylpiperazin-1-yl)methanone;hydrochloride (PubChem CID 119473354) has the molecular formula C11H17Cl2N3O and a molecular weight of 278.18 g/mol. Its IUPAC name is (4-chloro-1-methylpyrrol-2-yl)-(2-methylpiperazin-1-yl)methanone;hydrochloride.
| Compound Name | (4-chloro-1-methylpyrrol-2-yl)-(2-methylpiperazin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119473354 |
| Molecular Formula | C11H17Cl2N3O |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | (4-chloro-1-methylpyrrol-2-yl)-(2-methylpiperazin-1-yl)methanone;hydrochloride |
| SMILES | CC1CNCCN1C(=O)c1cc(Cl)cn1C.Cl |
| InChI | InChI=1S/C11H16ClN3O.ClH/c1-8-6-13-3-4-15(8)11(16)10-5-9(12)7-14(10)2;/h5,7-8,13H,3-4,6H2,1-2H3;1H |
| InChIKey | FPEWUGFWCIAICQ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |