C14H16N4O2 — CID 119473481
3-(2-methylpiperazine-1-carbonyl)pyrido[1,2-a]pyrimidin-4-one (PubChem CID 119473481) has the molecular formula C14H16N4O2 and a molecular weight of 272.31 g/mol. Its IUPAC name is 3-(2-methylpiperazine-1-carbonyl)pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-(2-methylpiperazine-1-carbonyl)pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 119473481 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 3-(2-methylpiperazine-1-carbonyl)pyrido[1,2-a]pyrimidin-4-one |
| SMILES | CC1CNCCN1C(=O)c1cnc2ccccn2c1=O |
| InChI | InChI=1S/C14H16N4O2/c1-10-8-15-5-7-17(10)13(19)11-9-16-12-4-2-3-6-18(12)14(11)20/h2-4,6,9-10,15H,5,7-8H2,1H3 |
| InChIKey | VHMGTIQHHNSNHL-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |