C28H46NO2+ — CID 11947436
(1R,2R,6S,9R,10S,11R,14R,15S,18S,20S,23R,24R)-10-hydroxy-6,10,20,23-tetramethyl-4-azoniahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosan-17-one (PubChem CID 11947436) has the molecular formula C28H46NO2+ and a molecular weight of 428.68 g/mol. Its IUPAC name is (1R,2R,6S,9R,10S,11R,14R,15S,18S,20S,23R,24R)-10-hydroxy-6,10,20,23-tetramethyl-4-azoniahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosan-17-one.
| Compound Name | (1R,2R,6S,9R,10S,11R,14R,15S,18S,20S,23R,24R)-10-hydroxy-6,10,20,23-tetramethyl-4-azoniahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosan-17-one |
|---|---|
| PubChem CID | 11947436 |
| Molecular Formula | C28H46NO2+ |
| Molecular Weight | 428.68 g/mol |
| Exact Mass | 428.35 |
| IUPAC Name | (1R,2R,6S,9R,10S,11R,14R,15S,18S,20S,23R,24R)-10-hydroxy-6,10,20,23-tetramethyl-4-azoniahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosan-17-one |
| SMILES | C[C@H]1CC[C@@]2(C)[C@H](C1)C(=O)C[C@H]1[C@H]3CC[C@@H]4[C@H](C[NH+]5C[C@@H](C)CC[C@@H]5[C@@]4(C)O)[C@@H]3C[C@H]12 |
| InChI | InChI=1S/C28H45NO2/c1-16-9-10-27(3)23-12-19-18(20(23)13-25(30)24(27)11-16)6-7-22-21(19)15-29-14-17(2)5-8-26(29)28(22,4)31/h16-24,26,31H,5-15H2,1-4H3/p+1/t16-,17-,18-,19+,20-,21+,22+,23+,24+,26+,27+,28-/m0/s1 |
| InChIKey | YSOKTNCRCPDOCA-NFRWQEDTSA-O |
| XLogP | 3.74 |
| TPSA | 41.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.68 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |