C11H22N2O6Pt — CID 11947711
2,2-bis(aminomethyl)propane-1,3-diol;cyclobutane-1,1-dicarboxylic acid;platinum (PubChem CID 11947711) has the molecular formula C11H22N2O6Pt and a molecular weight of 473.38 g/mol. Its IUPAC name is 2,2-bis(aminomethyl)propane-1,3-diol;cyclobutane-1,1-dicarboxylic acid;platinum.
| Compound Name | 2,2-bis(aminomethyl)propane-1,3-diol;cyclobutane-1,1-dicarboxylic acid;platinum |
|---|---|
| PubChem CID | 11947711 |
| Molecular Formula | C11H22N2O6Pt |
| Molecular Weight | 473.38 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | 2,2-bis(aminomethyl)propane-1,3-diol;cyclobutane-1,1-dicarboxylic acid;platinum |
| SMILES | NCC(CN)(CO)CO.O=C(O)C1(C(=O)O)CCC1.[Pt] |
| InChI | InChI=1S/C6H8O4.C5H14N2O2.Pt/c7-4(8)6(5(9)10)2-1-3-6;6-1-5(2-7,3-8)4-9;/h1-3H2,(H,7,8)(H,9,10);8-9H,1-4,6-7H2; |
| InChIKey | OOMDVERDMZLRFX-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 167.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.38 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|