C17H20F2N3O6PS — CID 11947802
[2-[4-(3,3-dimethylbutanoylamino)-3,5-difluorobenzoyl]imino-1,3-thiazol-3-yl]methyl dihydrogen phosphate (PubChem CID 11947802) has the molecular formula C17H20F2N3O6PS and a molecular weight of 463.40 g/mol. Its IUPAC name is [2-[4-(3,3-dimethylbutanoylamino)-3,5-difluorobenzoyl]imino-1,3-thiazol-3-yl]methyl dihydrogen phosphate.
| Compound Name | [2-[4-(3,3-dimethylbutanoylamino)-3,5-difluorobenzoyl]imino-1,3-thiazol-3-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 11947802 |
| Molecular Formula | C17H20F2N3O6PS |
| Molecular Weight | 463.40 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | [2-[4-(3,3-dimethylbutanoylamino)-3,5-difluorobenzoyl]imino-1,3-thiazol-3-yl]methyl dihydrogen phosphate |
| SMILES | CC(C)(C)CC(=O)Nc1c(F)cc(C(=O)/N=c2/sccn2COP(=O)(O)O)cc1F |
| InChI | InChI=1S/C17H20F2N3O6PS/c1-17(2,3)8-13(23)20-14-11(18)6-10(7-12(14)19)15(24)21-16-22(4-5-30-16)9-28-29(25,26)27/h4-7H,8-9H2,1-3H3,(H,20,23)(H2,25,26,27)/b21-16+ |
| InChIKey | MSWIQSFUBYCFJE-LTGZKZEYSA-N |
| XLogP | 3.01 |
| TPSA | 130.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|