C17H26N2O3 — CID 119478687
N-(4-aminocyclohexyl)-3-(3,4-dimethoxyphenyl)propanamide (PubChem CID 119478687) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-3-(3,4-dimethoxyphenyl)propanamide.
| Compound Name | N-(4-aminocyclohexyl)-3-(3,4-dimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 119478687 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | N-(4-aminocyclohexyl)-3-(3,4-dimethoxyphenyl)propanamide |
| SMILES | COc1ccc(CCC(=O)NC2CCC(N)CC2)cc1OC |
| InChI | InChI=1S/C17H26N2O3/c1-21-15-9-3-12(11-16(15)22-2)4-10-17(20)19-14-7-5-13(18)6-8-14/h3,9,11,13-14H,4-8,10,18H2,1-2H3,(H,19,20) |
| InChIKey | JXMRVZDWJPIXRY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |