C19H30ClN3O4 — CID 119479381
N-(2-aminoethyl)-1-[4-(4-methoxyphenoxy)butanoyl]piperidine-3-carboxamide;hydrochloride (PubChem CID 119479381) has the molecular formula C19H30ClN3O4 and a molecular weight of 399.92 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-[4-(4-methoxyphenoxy)butanoyl]piperidine-3-carboxamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-1-[4-(4-methoxyphenoxy)butanoyl]piperidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119479381 |
| Molecular Formula | C19H30ClN3O4 |
| Molecular Weight | 399.92 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | N-(2-aminoethyl)-1-[4-(4-methoxyphenoxy)butanoyl]piperidine-3-carboxamide;hydrochloride |
| SMILES | COc1ccc(OCCCC(=O)N2CCCC(C(=O)NCCN)C2)cc1.Cl |
| InChI | InChI=1S/C19H29N3O4.ClH/c1-25-16-6-8-17(9-7-16)26-13-3-5-18(23)22-12-2-4-15(14-22)19(24)21-11-10-20;/h6-9,15H,2-5,10-14,20H2,1H3,(H,21,24);1H |
| InChIKey | JVGQXENZYZSCOK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.92 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|